C9H16N2S — CID 158845487
2-methylidene-4-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 158845487) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 2-methylidene-4-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | 2-methylidene-4-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 158845487 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-methylidene-4-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | C=C1NC2CSC(C(C)C)C2N1 |
| InChI | InChI=1S/C9H16N2S/c1-5(2)9-8-7(4-12-9)10-6(3)11-8/h5,7-11H,3-4H2,1-2H3 |
| InChIKey | WSEGDIXSIKVKOF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |