C29H57NS — CID 161019144
N-but-1-en-2-yl-2,2-dimethylpropan-1-amine;(1E)-5-tert-butylcyclooctene;2,2-dimethyl-1-prop-2-enylsulfanylpropane (PubChem CID 161019144) has the molecular formula C29H57NS and a molecular weight of 451.85 g/mol. Its IUPAC name is N-but-1-en-2-yl-2,2-dimethylpropan-1-amine;(1E)-5-tert-butylcyclooctene;2,2-dimethyl-1-prop-2-enylsulfanylpropane.
| Compound Name | N-but-1-en-2-yl-2,2-dimethylpropan-1-amine;(1E)-5-tert-butylcyclooctene;2,2-dimethyl-1-prop-2-enylsulfanylpropane |
|---|---|
| PubChem CID | 161019144 |
| Molecular Formula | C29H57NS |
| Molecular Weight | 451.85 g/mol |
| Exact Mass | 451.42 |
| IUPAC Name | N-but-1-en-2-yl-2,2-dimethylpropan-1-amine;(1E)-5-tert-butylcyclooctene;2,2-dimethyl-1-prop-2-enylsulfanylpropane |
| SMILES | C=C(CC)NCC(C)(C)C.C=CCSCC(C)(C)C.CC(C)(C)C1CC/C=C\CCC1 |
| InChI | InChI=1S/C12H22.C9H19N.C8H16S/c1-12(2,3)11-9-7-5-4-6-8-10-11;1-6-8(2)10-7-9(3,4)5;1-5-6-9-7-8(2,3)4/h4-5,11H,6-10H2,1-3H3;10H,2,6-7H2,1,3-5H3;5H,1,6-7H2,2-4H3/b5-4-;; |
| InChIKey | TYCZMMTXOSJFRZ-WNCVTPEDSA-N |
| XLogP | 9.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.85 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|