C29H55NS — CID 146358976
N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hexa-1,5-dien-2-amine (PubChem CID 146358976) has the molecular formula C29H55NS and a molecular weight of 449.83 g/mol. Its IUPAC name is N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hexa-1,5-dien-2-amine.
| Compound Name | N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 146358976 |
| Molecular Formula | C29H55NS |
| Molecular Weight | 449.83 g/mol |
| Exact Mass | 449.41 |
| IUPAC Name | N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hexa-1,5-dien-2-amine |
| SMILES | C=CCCC(=C)NC(C)CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C29H55NS/c1-9-10-20-28(7)30-29(8)23-31-22-21-27(6)19-13-18-26(5)17-12-16-25(4)15-11-14-24(2)3/h9,21,24-26,29-30H,1,7,10-20,22-23H2,2-6,8H3/b27-21+ |
| InChIKey | HVXAYCJABIJKRD-SZXQPVLSSA-N |
| XLogP | 9.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.83 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|