C21H41NS — CID 138599460
7-[(3Z)-4-ethyl-1,1,3-trimethyl-1λ6-thiacycloocta-1,3,6-trien-1-yl]-N,6-dimethylheptan-2-amine (PubChem CID 138599460) has the molecular formula C21H41NS and a molecular weight of 339.63 g/mol. Its IUPAC name is 7-[(3Z)-4-ethyl-1,1,3-trimethyl-1λ6-thiacycloocta-1,3,6-trien-1-yl]-N,6-dimethylheptan-2-amine.
| Compound Name | 7-[(3Z)-4-ethyl-1,1,3-trimethyl-1λ6-thiacycloocta-1,3,6-trien-1-yl]-N,6-dimethylheptan-2-amine |
|---|---|
| PubChem CID | 138599460 |
| Molecular Formula | C21H41NS |
| Molecular Weight | 339.63 g/mol |
| Exact Mass | 339.30 |
| IUPAC Name | 7-[(3Z)-4-ethyl-1,1,3-trimethyl-1λ6-thiacycloocta-1,3,6-trien-1-yl]-N,6-dimethylheptan-2-amine |
| SMILES | CC/C1=C(\C)C=S(C)(C)(CC(C)CCCC(C)NC)CC=CC1 |
| InChI | InChI=1S/C21H41NS/c1-8-21-14-9-10-15-23(6,7,17-19(21)3)16-18(2)12-11-13-20(4)22-5/h9-10,17-18,20,22H,8,11-16H2,1-7H3/b10-9?,21-19- |
| InChIKey | AUUHZGDBXQSUHV-MGAHFUHESA-N |
| XLogP | 5.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|