C30H54NS- — CID 59116855
3-nonyl-5-octyl-N-[(E)-pent-1-enyl]-4-propan-2-ylsulfanylcyclopenta-1,3-dien-1-amine (PubChem CID 59116855) has the molecular formula C30H54NS- and a molecular weight of 460.84 g/mol. Its IUPAC name is 3-nonyl-5-octyl-N-[(E)-pent-1-enyl]-4-propan-2-ylsulfanylcyclopenta-1,3-dien-1-amine.
| Compound Name | 3-nonyl-5-octyl-N-[(E)-pent-1-enyl]-4-propan-2-ylsulfanylcyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 59116855 |
| Molecular Formula | C30H54NS- |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 460.40 |
| IUPAC Name | 3-nonyl-5-octyl-N-[(E)-pent-1-enyl]-4-propan-2-ylsulfanylcyclopenta-1,3-dien-1-amine |
| SMILES | C[CH-]C/C=C/NC1=CC(CCCCCCCCC)=C(SC(C)C)C1CCCCCCCC |
| InChI | InChI=1S/C30H54NS/c1-6-9-12-14-16-17-19-22-27-25-29(31-24-21-11-8-3)28(30(27)32-26(4)5)23-20-18-15-13-10-7-2/h8,21,24-26,28,31H,6-7,9-20,22-23H2,1-5H3/q-1/b24-21+ |
| InChIKey | PSDATOIFLSOFNA-DARPEHSRSA-N |
| XLogP | 10.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|