C40H74NS- — CID 59116884
2-decyl-3-nonyl-5-octyl-N-[(E)-pent-1-enyl]-4-propan-2-ylsulfanylcyclopenta-1,3-dien-1-amine (PubChem CID 59116884) has the molecular formula C40H74NS- and a molecular weight of 601.11 g/mol. Its IUPAC name is 2-decyl-3-nonyl-5-octyl-N-[(E)-pent-1-enyl]-4-propan-2-ylsulfanylcyclopenta-1,3-dien-1-amine.
| Compound Name | 2-decyl-3-nonyl-5-octyl-N-[(E)-pent-1-enyl]-4-propan-2-ylsulfanylcyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 59116884 |
| Molecular Formula | C40H74NS- |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 600.55 |
| IUPAC Name | 2-decyl-3-nonyl-5-octyl-N-[(E)-pent-1-enyl]-4-propan-2-ylsulfanylcyclopenta-1,3-dien-1-amine |
| SMILES | C[CH-]C/C=C/NC1=C(CCCCCCCCCC)C(CCCCCCCCC)=C(SC(C)C)C1CCCCCCCC |
| InChI | InChI=1S/C40H74NS/c1-7-11-15-18-21-23-25-27-31-36-37(32-28-26-22-19-16-12-8-2)40(42-35(5)6)38(33-29-24-20-17-13-9-3)39(36)41-34-30-14-10-4/h10,30,34-35,38,41H,7-9,11-29,31-33H2,1-6H3/q-1/b34-30+ |
| InChIKey | FEHOWAQCSPDPTG-VBMGMRCRSA-N |
| XLogP | 14.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|