C31H54N2S — CID 143021654
(10Z)-N-ethyl-2,4,5,6,10-pentamethyl-13-[(E)-1-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-3-methylidenehexadeca-10,15-dien-2-amine (PubChem CID 143021654) has the molecular formula C31H54N2S and a molecular weight of 486.85 g/mol. Its IUPAC name is (10Z)-N-ethyl-2,4,5,6,10-pentamethyl-13-[(E)-1-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-3-methylidenehexadeca-10,15-dien-2-amine.
| Compound Name | (10Z)-N-ethyl-2,4,5,6,10-pentamethyl-13-[(E)-1-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-3-methylidenehexadeca-10,15-dien-2-amine |
|---|---|
| PubChem CID | 143021654 |
| Molecular Formula | C31H54N2S |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 486.40 |
| IUPAC Name | (10Z)-N-ethyl-2,4,5,6,10-pentamethyl-13-[(E)-1-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)prop-1-en-2-yl]-3-methylidenehexadeca-10,15-dien-2-amine |
| SMILES | C=CCC(C/C=C(/C)CCCC(C)C(C)C(C)C(=C)C(C)(C)NCC)/C(C)=C/C1=CSC(C)N1 |
| InChI | InChI=1S/C31H54N2S/c1-12-15-29(24(5)20-30-21-34-28(9)33-30)19-18-22(3)16-14-17-23(4)25(6)26(7)27(8)31(10,11)32-13-2/h12,18,20-21,23,25-26,28-29,32-33H,1,8,13-17,19H2,2-7,9-11H3/b22-18-,24-20+ |
| InChIKey | KAQZFKIBLQUYBW-RTCHKDDQSA-N |
| XLogP | 9.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|