About N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline
N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline (PubChem CID 159762169) has the molecular formula C19H16Br2Cl2N2
and a molecular weight of 503.07 g/mol. Its IUPAC name is N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline.
Molecular Properties
| Compound Name | N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline |
| PubChem CID | 159762169 |
| Molecular Formula | C19H16Br2Cl2N2 |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 499.91 |
| IUPAC Name | N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline |
| SMILES | Clc1ccc(NCc2ccccc2)cc1Br.Nc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H11BrClN.C6H5BrClN/c14-12-8-11(6-7-13(12)15)16-9-10-4-2-1-3-5-10;7-5-3-4(9)1-2-6(5)8/h1-8,16H,9H2;1-3H,9H2 |
| InChIKey | NFANBNDNSLTTHK-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline?
The IUPAC name of N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline (CID 159762169) is N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline.
What is the SMILES notation for N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline?
The canonical SMILES for N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline is Clc1ccc(NCc2ccccc2)cc1Br.Nc1ccc(Cl)c(Br)c1.
What is the InChIKey of N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline?
The InChIKey is NFANBNDNSLTTHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrClN.C6H5BrClN/c14-12-8-11(6-7-13(12)15)16-9-10-4-2-1-3-5-10;7-5-3-4(9)1-2-6(5)8/h1-8,16H,9H2;1-3H,9H2.
What are the key properties of N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline?
N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline has a molecular weight of 503.07 g/mol, XLogP of 7.40, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-bromo-4-chloroaniline;3-bromo-4-chloroaniline is sourced from PubChem (CID 159762169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).