C14H26O4 — CID 159773802
2-cyclohex-3-en-1-yloxirane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 159773802) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yloxirane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-cyclohex-3-en-1-yloxirane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 159773802 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-cyclohex-3-en-1-yloxirane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | C1=CCC(C2CO2)CC1.CCC(CO)(CO)CO |
| InChI | InChI=1S/C8H12O.C6H14O3/c1-2-4-7(5-3-1)8-6-9-8;1-2-6(3-7,4-8)5-9/h1-2,7-8H,3-6H2;7-9H,2-5H2,1H3 |
| InChIKey | NGLTUCWUYFASQM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|