C28H28N4P+ — CID 159777979
[4-[[[amino-(1-aminoethylideneamino)methylidene]amino]methyl]phenyl]-triphenylphosphanium (PubChem CID 159777979) has the molecular formula C28H28N4P+ and a molecular weight of 451.53 g/mol. Its IUPAC name is [4-[[[amino-(1-aminoethylideneamino)methylidene]amino]methyl]phenyl]-triphenylphosphanium.
| Compound Name | [4-[[[amino-(1-aminoethylideneamino)methylidene]amino]methyl]phenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 159777979 |
| Molecular Formula | C28H28N4P+ |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [4-[[[amino-(1-aminoethylideneamino)methylidene]amino]methyl]phenyl]-triphenylphosphanium |
| SMILES | CC(N)=N/C(N)=N/Cc1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N4P/c1-22(29)32-28(30)31-21-23-17-19-27(20-18-23)33(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-20H,21H2,1H3,(H4,29,30,31,32)/q+1 |
| InChIKey | KQBXRHVAQHLALR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|