C33H31N5P+ — CID 129056312
[4-[4-[[[amino-(diaminomethylideneamino)methylidene]amino]methyl]phenyl]phenyl]-triphenylphosphanium (PubChem CID 129056312) has the molecular formula C33H31N5P+ and a molecular weight of 528.62 g/mol. Its IUPAC name is [4-[4-[[[amino-(diaminomethylideneamino)methylidene]amino]methyl]phenyl]phenyl]-triphenylphosphanium.
| Compound Name | [4-[4-[[[amino-(diaminomethylideneamino)methylidene]amino]methyl]phenyl]phenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 129056312 |
| Molecular Formula | C33H31N5P+ |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | [4-[4-[[[amino-(diaminomethylideneamino)methylidene]amino]methyl]phenyl]phenyl]-triphenylphosphanium |
| SMILES | NC(N)=N/C(N)=N/Cc1ccc(-c2ccc([P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H31N5P/c34-32(35)38-33(36)37-24-25-16-18-26(19-17-25)27-20-22-31(23-21-27)39(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-23H,24H2,(H6,34,35,36,37,38)/q+1 |
| InChIKey | RGWWXYHKOOVIDD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|