C50H44O17 — CID 159783516
[4-[2-(3,4-dihydroxyphenoxy)-2-oxoethoxy]phenyl] 2-methylprop-2-enoate;[4-(3,4-dihydroxyphenoxy)phenyl] 2-methylprop-2-enoate;(3,4-dihydroxyphenyl) 2-(4-ethenylphenoxy)acetate (PubChem CID 159783516) has the molecular formula C50H44O17 and a molecular weight of 916.88 g/mol. Its IUPAC name is [4-[2-(3,4-dihydroxyphenoxy)-2-oxoethoxy]phenyl] 2-methylprop-2-enoate;[4-(3,4-dihydroxyphenoxy)phenyl] 2-methylprop-2-enoate;(3,4-dihydroxyphenyl) 2-(4-ethenylphenoxy)acetate.
| Compound Name | [4-[2-(3,4-dihydroxyphenoxy)-2-oxoethoxy]phenyl] 2-methylprop-2-enoate;[4-(3,4-dihydroxyphenoxy)phenyl] 2-methylprop-2-enoate;(3,4-dihydroxyphenyl) 2-(4-ethenylphenoxy)acetate |
|---|---|
| PubChem CID | 159783516 |
| Molecular Formula | C50H44O17 |
| Molecular Weight | 916.88 g/mol |
| Exact Mass | 916.26 |
| IUPAC Name | [4-[2-(3,4-dihydroxyphenoxy)-2-oxoethoxy]phenyl] 2-methylprop-2-enoate;[4-(3,4-dihydroxyphenoxy)phenyl] 2-methylprop-2-enoate;(3,4-dihydroxyphenyl) 2-(4-ethenylphenoxy)acetate |
| SMILES | C=C(C)C(=O)Oc1ccc(OCC(=O)Oc2ccc(O)c(O)c2)cc1.C=C(C)C(=O)Oc1ccc(Oc2ccc(O)c(O)c2)cc1.C=Cc1ccc(OCC(=O)Oc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C18H16O7.2C16H14O5/c1-11(2)18(22)25-13-5-3-12(4-6-13)23-10-17(21)24-14-7-8-15(19)16(20)9-14;1-10(2)16(19)21-12-5-3-11(4-6-12)20-13-7-8-14(17)15(18)9-13;1-2-11-3-5-12(6-4-11)20-10-16(19)21-13-7-8-14(17)15(18)9-13/h3-9,19-20H,1,10H2,2H3;3-9,17-18H,1H2,2H3;2-9,17-18H,1,10H2 |
| InChIKey | NHQVIVXSMPWURF-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 254.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.88 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|