About 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate
3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate (PubChem CID 19369048) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate |
| PubChem CID | 19369048 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate |
| SMILES | C=Cc1ccc(OCC(=O)OCC=C(C)C)cc1 |
| InChI | InChI=1S/C15H18O3/c1-4-13-5-7-14(8-6-13)18-11-15(16)17-10-9-12(2)3/h4-9H,1,10-11H2,2-3H3 |
| InChIKey | LVSDXVWHSCNNSM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate?
The IUPAC name of 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate (CID 19369048) is 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate.
What is the SMILES notation for 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate?
The canonical SMILES for 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate is C=Cc1ccc(OCC(=O)OCC=C(C)C)cc1.
What is the InChIKey of 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate?
The InChIKey is LVSDXVWHSCNNSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c1-4-13-5-7-14(8-6-13)18-11-15(16)17-10-9-12(2)3/h4-9H,1,10-11H2,2-3H3.
What are the key properties of 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate?
3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate has a molecular weight of 246.31 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl 2-(4-ethenylphenoxy)acetate is sourced from PubChem (CID 19369048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).