C19H26NO2+ — CID 20639672
[(2E)-3,7-dimethylocta-2,6-dienyl] 2-(4-ethenylpyridin-1-ium-1-yl)acetate (PubChem CID 20639672) has the molecular formula C19H26NO2+ and a molecular weight of 300.42 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(4-ethenylpyridin-1-ium-1-yl)acetate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(4-ethenylpyridin-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 20639672 |
| Molecular Formula | C19H26NO2+ |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(4-ethenylpyridin-1-ium-1-yl)acetate |
| SMILES | C=Cc1cc[n+](CC(=O)OC/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C19H26NO2/c1-5-18-9-12-20(13-10-18)15-19(21)22-14-11-17(4)8-6-7-16(2)3/h5,7,9-13H,1,6,8,14-15H2,2-4H3/q+1/b17-11+ |
| InChIKey | GPBTZWWZBUIHTH-GZTJUZNOSA-N |
| XLogP | 3.85 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|