C29H38F3NO5 — CID 159784964
tert-butyl 3-[4-[5-[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]-3-oxopentan-2-yl]-2-methoxyphenyl]propanoate (PubChem CID 159784964) has the molecular formula C29H38F3NO5 and a molecular weight of 537.62 g/mol. Its IUPAC name is tert-butyl 3-[4-[5-[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]-3-oxopentan-2-yl]-2-methoxyphenyl]propanoate.
| Compound Name | tert-butyl 3-[4-[5-[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]-3-oxopentan-2-yl]-2-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 159784964 |
| Molecular Formula | C29H38F3NO5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | tert-butyl 3-[4-[5-[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]-3-oxopentan-2-yl]-2-methoxyphenyl]propanoate |
| SMILES | CCCCOc1nc(C(F)(F)F)ccc1CCC(=O)C(C)c1ccc(CCC(=O)OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C29H38F3NO5/c1-7-8-17-37-27-21(12-15-25(33-27)29(30,31)32)11-14-23(34)19(2)22-10-9-20(24(18-22)36-6)13-16-26(35)38-28(3,4)5/h9-10,12,15,18-19H,7-8,11,13-14,16-17H2,1-6H3 |
| InChIKey | OGVAIEGGVAYYLN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|