C20H25FN4O4 — CID 15978506
N-[[(5S)-3-[3-fluoro-4-(6-methoxyimino-1-methyl-3-azabicyclo[3.1.1]heptan-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 15978506) has the molecular formula C20H25FN4O4 and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-(6-methoxyimino-1-methyl-3-azabicyclo[3.1.1]heptan-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-(6-methoxyimino-1-methyl-3-azabicyclo[3.1.1]heptan-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 15978506 |
| Molecular Formula | C20H25FN4O4 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-(6-methoxyimino-1-methyl-3-azabicyclo[3.1.1]heptan-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CON=C1C2CN(c3ccc(N4C[C@H](CNC(C)=O)OC4=O)cc3F)CC1(C)C2 |
| InChI | InChI=1S/C20H25FN4O4/c1-12(26)22-8-15-10-25(19(27)29-15)14-4-5-17(16(21)6-14)24-9-13-7-20(2,11-24)18(13)23-28-3/h4-6,13,15H,7-11H2,1-3H3,(H,22,26)/t13?,15-,20?/m0/s1 |
| InChIKey | QNWQXBBXTSTOQE-LXDLAPCHSA-N |
| XLogP | 2.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|