C25H30N6OS — CID 159792682
6-N,6-N,9-trimethyl-2-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine (PubChem CID 159792682) has the molecular formula C25H30N6OS and a molecular weight of 462.62 g/mol. Its IUPAC name is 6-N,6-N,9-trimethyl-2-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine.
| Compound Name | 6-N,6-N,9-trimethyl-2-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
|---|---|
| PubChem CID | 159792682 |
| Molecular Formula | C25H30N6OS |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 6-N,6-N,9-trimethyl-2-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-5,6,7,8-tetrahydropyrido[2,3-b]indole-2,6-diamine |
| SMILES | CN(C)C1CCc2c(c3ccc(Nc4ccc5nc(N6CCOCC6)sc5c4)nc3n2C)C1 |
| InChI | InChI=1S/C25H30N6OS/c1-29(2)17-5-8-21-19(15-17)18-6-9-23(28-24(18)30(21)3)26-16-4-7-20-22(14-16)33-25(27-20)31-10-12-32-13-11-31/h4,6-7,9,14,17H,5,8,10-13,15H2,1-3H3,(H,26,28) |
| InChIKey | NITOBQRNRIGLNU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |