About (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate
(2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate (PubChem CID 159795162) has the molecular formula C29H33NO2
and a molecular weight of 427.59 g/mol. Its IUPAC name is (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate.
Molecular Properties
| Compound Name | (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate |
| PubChem CID | 159795162 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate |
| SMILES | CC(C)(C)c1ccc2c(c1)C(COC(=O)Cc1ccccn1)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C29H33NO2/c1-28(2,3)19-10-12-22-23-13-11-20(29(4,5)6)16-25(23)26(24(22)15-19)18-32-27(31)17-21-9-7-8-14-30-21/h7-16,26H,17-18H2,1-6H3 |
| InChIKey | HUCHYYRKDSKVLA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate?
The IUPAC name of (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate (CID 159795162) is (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate.
What is the SMILES notation for (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate?
The canonical SMILES for (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate is CC(C)(C)c1ccc2c(c1)C(COC(=O)Cc1ccccn1)c1cc(C(C)(C)C)ccc1-2.
What is the InChIKey of (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate?
The InChIKey is HUCHYYRKDSKVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H33NO2/c1-28(2,3)19-10-12-22-23-13-11-20(29(4,5)6)16-25(23)26(24(22)15-19)18-32-27(31)17-21-9-7-8-14-30-21/h7-16,26H,17-18H2,1-6H3.
What are the key properties of (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate?
(2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate has a molecular weight of 427.59 g/mol, XLogP of 6.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,7-ditert-butyl-9H-fluoren-9-yl)methyl 2-pyridin-2-ylacetate is sourced from PubChem (CID 159795162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).