C14H18ClN2O4- — CID 159798086
2-(3-chloro-5-methylphenyl)-2-hydroxyacetate;pyrrolidine-2-carboxamide (PubChem CID 159798086) has the molecular formula C14H18ClN2O4- and a molecular weight of 313.76 g/mol. Its IUPAC name is 2-(3-chloro-5-methylphenyl)-2-hydroxyacetate;pyrrolidine-2-carboxamide.
| Compound Name | 2-(3-chloro-5-methylphenyl)-2-hydroxyacetate;pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 159798086 |
| Molecular Formula | C14H18ClN2O4- |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-(3-chloro-5-methylphenyl)-2-hydroxyacetate;pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(Cl)cc(C(O)C(=O)[O-])c1.NC(=O)C1CCCN1 |
| InChI | InChI=1S/C9H9ClO3.C5H10N2O/c1-5-2-6(4-7(10)3-5)8(11)9(12)13;6-5(8)4-2-1-3-7-4/h2-4,8,11H,1H3,(H,12,13);4,7H,1-3H2,(H2,6,8)/p-1 |
| InChIKey | NJKTXVXVXMPEEV-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |