C23H25N3O2S — CID 159807289
6-(1-amino-3-methyliminoprop-1-en-2-yl)-2-methyl-4-(2-propoxy-5-sulfanylphenyl)isoquinolin-1-one (PubChem CID 159807289) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 6-(1-amino-3-methyliminoprop-1-en-2-yl)-2-methyl-4-(2-propoxy-5-sulfanylphenyl)isoquinolin-1-one.
| Compound Name | 6-(1-amino-3-methyliminoprop-1-en-2-yl)-2-methyl-4-(2-propoxy-5-sulfanylphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 159807289 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 6-(1-amino-3-methyliminoprop-1-en-2-yl)-2-methyl-4-(2-propoxy-5-sulfanylphenyl)isoquinolin-1-one |
| SMILES | CCCOc1ccc(S)cc1-c1cn(C)c(=O)c2ccc(C(=CN)/C=N/C)cc12 |
| InChI | InChI=1S/C23H25N3O2S/c1-4-9-28-22-8-6-17(29)11-20(22)21-14-26(3)23(27)18-7-5-15(10-19(18)21)16(12-24)13-25-2/h5-8,10-14,29H,4,9,24H2,1-3H3/b16-12?,25-13+ |
| InChIKey | XBEHUQROKZUPTE-AQIWCZFTSA-N |
| XLogP | 4.28 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|