C20H40N4O3 — CID 159813624
methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate (PubChem CID 159813624) has the molecular formula C20H40N4O3 and a molecular weight of 384.57 g/mol. Its IUPAC name is methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate.
| Compound Name | methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate |
|---|---|
| PubChem CID | 159813624 |
| Molecular Formula | C20H40N4O3 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate |
| SMILES | COC(=O)CC(C(O)CN1CCCCCNCC1)N1CCCCCNCC1 |
| InChI | InChI=1S/C20H40N4O3/c1-27-20(26)16-18(24-13-7-3-5-9-22-11-15-24)19(25)17-23-12-6-2-4-8-21-10-14-23/h18-19,21-22,25H,2-17H2,1H3 |
| InChIKey | KQMIUUYBFCQJIO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |