methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate

C20H40N4O3 — CID 159813624

IUPACmethyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate
SMILESCOC(=O)CC(C(O)CN1CCCCCNCC1)N1CCCCCNCC1
InChIInChI=1S/C20H40N4O3/c1-27-20(26)16-18(24-13-7-3-5-9-22-11-15-24)19(25)17-23-12-6-2-4-8-21-10-14-23/h18-19,21-22,25H,2-17H2,1H3
InChIKeyKQMIUUYBFCQJIO-UHFFFAOYSA-N
MW384.57 g/mol
LogP0.43
Rot. Bonds6

About methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate

methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate (PubChem CID 159813624) has the molecular formula C20H40N4O3 and a molecular weight of 384.57 g/mol. Its IUPAC name is methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate.

Molecular Properties

Compound Namemethyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate
PubChem CID159813624
Molecular FormulaC20H40N4O3
Molecular Weight384.57 g/mol
Exact Mass384.31
IUPAC Namemethyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate
SMILESCOC(=O)CC(C(O)CN1CCCCCNCC1)N1CCCCCNCC1
InChIInChI=1S/C20H40N4O3/c1-27-20(26)16-18(24-13-7-3-5-9-22-11-15-24)19(25)17-23-12-6-2-4-8-21-10-14-23/h18-19,21-22,25H,2-17H2,1H3
InChIKeyKQMIUUYBFCQJIO-UHFFFAOYSA-N
XLogP0.43
TPSA77.07 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500384.57
LogP ≤ 50.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Analyze methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate?
The IUPAC name of methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate (CID 159813624) is methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate.
What is the SMILES notation for methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate?
The canonical SMILES for methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate is COC(=O)CC(C(O)CN1CCCCCNCC1)N1CCCCCNCC1.
What is the InChIKey of methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate?
The InChIKey is KQMIUUYBFCQJIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40N4O3/c1-27-20(26)16-18(24-13-7-3-5-9-22-11-15-24)19(25)17-23-12-6-2-4-8-21-10-14-23/h18-19,21-22,25H,2-17H2,1H3.
What are the key properties of methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate?
methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate has a molecular weight of 384.57 g/mol, XLogP of 0.43, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-bis(1,4-diazonan-1-yl)-4-hydroxypentanoate is sourced from PubChem (CID 159813624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).