C17H21BrN6 — CID 159813952
2-[3-[(4-amino-1,2,4-triazol-4-ium-1-yl)methyl]-5-(2-isocyanopropan-2-yl)phenyl]-2-methylpropanenitrile bromide (PubChem CID 159813952) has the molecular formula C17H21BrN6 and a molecular weight of 389.30 g/mol. Its IUPAC name is 2-[3-[(4-amino-1,2,4-triazol-4-ium-1-yl)methyl]-5-(2-isocyanopropan-2-yl)phenyl]-2-methylpropanenitrile bromide.
| Compound Name | 2-[3-[(4-amino-1,2,4-triazol-4-ium-1-yl)methyl]-5-(2-isocyanopropan-2-yl)phenyl]-2-methylpropanenitrile bromide |
|---|---|
| PubChem CID | 159813952 |
| Molecular Formula | C17H21BrN6 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[3-[(4-amino-1,2,4-triazol-4-ium-1-yl)methyl]-5-(2-isocyanopropan-2-yl)phenyl]-2-methylpropanenitrile bromide |
| SMILES | [Br-].[C-]#[N+]C(C)(C)c1cc(Cn2c[n+](N)cn2)cc(C(C)(C)C#N)c1 |
| InChI | InChI=1S/C17H21N6.BrH/c1-16(2,10-18)14-6-13(9-23-12-22(19)11-21-23)7-15(8-14)17(3,4)20-5;/h6-8,11-12H,9,19H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FIFVAKWTYJSIOM-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|