About piperidine-1-carboxylic acid;triphenylphosphane
piperidine-1-carboxylic acid;triphenylphosphane (PubChem CID 159814521) has the molecular formula C24H26NO2P
and a molecular weight of 391.45 g/mol. Its IUPAC name is piperidine-1-carboxylic acid;triphenylphosphane.
Molecular Properties
| Compound Name | piperidine-1-carboxylic acid;triphenylphosphane |
| PubChem CID | 159814521 |
| Molecular Formula | C24H26NO2P |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | piperidine-1-carboxylic acid;triphenylphosphane |
| SMILES | O=C(O)N1CCCCC1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C6H11NO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6(9)7-4-2-1-3-5-7/h1-15H;1-5H2,(H,8,9) |
| InChIKey | NLLDTTNUGNIJQI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze piperidine-1-carboxylic acid;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-1-carboxylic acid;triphenylphosphane?
The IUPAC name of piperidine-1-carboxylic acid;triphenylphosphane (CID 159814521) is piperidine-1-carboxylic acid;triphenylphosphane.
What is the SMILES notation for piperidine-1-carboxylic acid;triphenylphosphane?
The canonical SMILES for piperidine-1-carboxylic acid;triphenylphosphane is O=C(O)N1CCCCC1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of piperidine-1-carboxylic acid;triphenylphosphane?
The InChIKey is NLLDTTNUGNIJQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C6H11NO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;8-6(9)7-4-2-1-3-5-7/h1-15H;1-5H2,(H,8,9).
What are the key properties of piperidine-1-carboxylic acid;triphenylphosphane?
piperidine-1-carboxylic acid;triphenylphosphane has a molecular weight of 391.45 g/mol, XLogP of 4.60, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1-carboxylic acid;triphenylphosphane is sourced from PubChem (CID 159814521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).