C27H24N10O3 — CID 15982464
3-N,7-N,11-N-tris(4-methoxyphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene-3,7,11-triamine (PubChem CID 15982464) has the molecular formula C27H24N10O3 and a molecular weight of 536.56 g/mol. Its IUPAC name is 3-N,7-N,11-N-tris(4-methoxyphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene-3,7,11-triamine.
| Compound Name | 3-N,7-N,11-N-tris(4-methoxyphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene-3,7,11-triamine |
|---|---|
| PubChem CID | 15982464 |
| Molecular Formula | C27H24N10O3 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 3-N,7-N,11-N-tris(4-methoxyphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene-3,7,11-triamine |
| SMILES | COc1ccc(NC2=NC3=NC(Nc4ccc(OC)cc4)=NC4=NC(Nc5ccc(OC)cc5)=NC(=N2)N34)cc1 |
| InChI | InChI=1S/C27H24N10O3/c1-38-19-10-4-16(5-11-19)28-22-31-25-33-23(29-17-6-12-20(39-2)13-7-17)35-27-36-24(34-26(32-22)37(25)27)30-18-8-14-21(40-3)15-9-18/h4-15H,1-3H3,(H3,28,29,30,31,32,33,34,35,36) |
| InChIKey | ZLPBVDNDADXEER-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |