C25H25ClO2 — CID 15982684
(E)-3-[3-(4-chlorophenyl)-1-adamantyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 15982684) has the molecular formula C25H25ClO2 and a molecular weight of 392.93 g/mol. Its IUPAC name is (E)-3-[3-(4-chlorophenyl)-1-adamantyl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-(4-chlorophenyl)-1-adamantyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 15982684 |
| Molecular Formula | C25H25ClO2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (E)-3-[3-(4-chlorophenyl)-1-adamantyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/C12CC3CC(C1)CC(c1ccc(Cl)cc1)(C3)C2)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H25ClO2/c26-21-5-3-20(4-6-21)25-14-17-11-18(15-25)13-24(12-17,16-25)10-9-23(28)19-1-7-22(27)8-2-19/h1-10,17-18,27H,11-16H2/b10-9+ |
| InChIKey | OFDZJJVDRXPMTL-MDZDMXLPSA-N |
| XLogP | 6.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|