C16H15N3 — CID 159829847
3-pyridin-3-yl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 159829847) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-pyridin-3-yl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 3-pyridin-3-yl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 159829847 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-pyridin-3-yl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | c1cncc(C2Cc3[nH]c4ccccc4c3CN2)c1 |
| InChI | InChI=1S/C16H15N3/c1-2-6-14-12(5-1)13-10-18-15(8-16(13)19-14)11-4-3-7-17-9-11/h1-7,9,15,18-19H,8,10H2 |
| InChIKey | FKIVCOQLAFYLND-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|