C29H31N3O5 — CID 15983080
1-[4-[2-(cyclopentylamino)ethoxy]-3-methoxyphenyl]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione (PubChem CID 15983080) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is 1-[4-[2-(cyclopentylamino)ethoxy]-3-methoxyphenyl]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 1-[4-[2-(cyclopentylamino)ethoxy]-3-methoxyphenyl]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 15983080 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 1-[4-[2-(cyclopentylamino)ethoxy]-3-methoxyphenyl]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1cc(N2CC(=O)N(c3ccc(Oc4ccccc4)cc3)C2=O)ccc1OCCNC1CCCC1 |
| InChI | InChI=1S/C29H31N3O5/c1-35-27-19-23(13-16-26(27)36-18-17-30-21-7-5-6-8-21)31-20-28(33)32(29(31)34)22-11-14-25(15-12-22)37-24-9-3-2-4-10-24/h2-4,9-16,19,21,30H,5-8,17-18,20H2,1H3 |
| InChIKey | VCKIQNFLZHGYFX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|