C29H31N3O4 — CID 71218001
3-(4-benzylphenyl)-1-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 71218001) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-(4-benzylphenyl)-1-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-(4-benzylphenyl)-1-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71218001 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3-(4-benzylphenyl)-1-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | COc1cc(N2CC(=O)N(c3ccc(Cc4ccccc4)cc3)C2=O)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C29H31N3O4/c1-35-27-20-25(13-14-26(27)36-18-17-30-15-5-6-16-30)31-21-28(33)32(29(31)34)24-11-9-23(10-12-24)19-22-7-3-2-4-8-22/h2-4,7-14,20H,5-6,15-19,21H2,1H3 |
| InChIKey | PEWBCKNJWASITI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|