C28H31N3O5 — CID 71218185
1-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione (PubChem CID 71218185) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is 1-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 1-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71218185 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 1-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-3-(4-phenoxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCN(CC)CCOc1ccc(N2CC(=O)N(c3ccc(Oc4ccccc4)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C28H31N3O5/c1-4-29(5-2)17-18-35-25-16-13-22(19-26(25)34-3)30-20-27(32)31(28(30)33)21-11-14-24(15-12-21)36-23-9-7-6-8-10-23/h6-16,19H,4-5,17-18,20H2,1-3H3 |
| InChIKey | BQBBHCRSCMOPKD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|