C22H25N3O4 — CID 71218006
1-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-phenylimidazolidine-2,4-dione (PubChem CID 71218006) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-phenylimidazolidine-2,4-dione.
| Compound Name | 1-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71218006 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-3-phenylimidazolidine-2,4-dione |
| SMILES | COc1cc(N2CC(=O)N(c3ccccc3)C2=O)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C22H25N3O4/c1-28-20-15-18(9-10-19(20)29-14-13-23-11-5-6-12-23)24-16-21(26)25(22(24)27)17-7-3-2-4-8-17/h2-4,7-10,15H,5-6,11-14,16H2,1H3 |
| InChIKey | KHZKFMUJDYSFCH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|