C20H23NO6 — CID 159831217
dipropyl (Z)-but-2-enedioate;3-phenylpyrrole-2,5-dione (PubChem CID 159831217) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is dipropyl (Z)-but-2-enedioate;3-phenylpyrrole-2,5-dione.
| Compound Name | dipropyl (Z)-but-2-enedioate;3-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 159831217 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | dipropyl (Z)-but-2-enedioate;3-phenylpyrrole-2,5-dione |
| SMILES | CCCOC(=O)/C=C\C(=O)OCCC.O=C1C=C(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C10H7NO2.C10H16O4/c12-9-6-8(10(13)11-9)7-4-2-1-3-5-7;1-3-7-13-9(11)5-6-10(12)14-8-4-2/h1-6H,(H,11,12,13);5-6H,3-4,7-8H2,1-2H3/b;6-5- |
| InChIKey | NNMGSGYJQKLLTH-JXGYXAOLSA-N |
| XLogP | 2.18 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|