C20H26N2O4 — CID 137348353
ethyl (Z,4S)-5-[(3S)-2-oxopyrrolidin-3-yl]-4-(3-phenylpropanoylamino)pent-2-enoate (PubChem CID 137348353) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is ethyl (Z,4S)-5-[(3S)-2-oxopyrrolidin-3-yl]-4-(3-phenylpropanoylamino)pent-2-enoate.
| Compound Name | ethyl (Z,4S)-5-[(3S)-2-oxopyrrolidin-3-yl]-4-(3-phenylpropanoylamino)pent-2-enoate |
|---|---|
| PubChem CID | 137348353 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | ethyl (Z,4S)-5-[(3S)-2-oxopyrrolidin-3-yl]-4-(3-phenylpropanoylamino)pent-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@H](C[C@@H]1CCNC1=O)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H26N2O4/c1-2-26-19(24)11-9-17(14-16-12-13-21-20(16)25)22-18(23)10-8-15-6-4-3-5-7-15/h3-7,9,11,16-17H,2,8,10,12-14H2,1H3,(H,21,25)(H,22,23)/b11-9-/t16-,17+/m0/s1 |
| InChIKey | QZQFSCIYJVNTSL-UMYABFQBSA-N |
| XLogP | 1.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|