C12H16I2O2V — CID 159831301
diiodovanadium;1-(2-hydroxy-3,4,5,6-tetramethylphenyl)ethanone (PubChem CID 159831301) has the molecular formula C12H16I2O2V and a molecular weight of 497.01 g/mol. Its IUPAC name is diiodovanadium;1-(2-hydroxy-3,4,5,6-tetramethylphenyl)ethanone.
| Compound Name | diiodovanadium;1-(2-hydroxy-3,4,5,6-tetramethylphenyl)ethanone |
|---|---|
| PubChem CID | 159831301 |
| Molecular Formula | C12H16I2O2V |
| Molecular Weight | 497.01 g/mol |
| Exact Mass | 496.87 |
| IUPAC Name | diiodovanadium;1-(2-hydroxy-3,4,5,6-tetramethylphenyl)ethanone |
| SMILES | CC(=O)c1c(C)c(C)c(C)c(C)c1O.I[V]I |
| InChI | InChI=1S/C12H16O2.2HI.V/c1-6-7(2)9(4)12(14)11(8(6)3)10(5)13;;;/h14H,1-5H3;2*1H;/q;;;+2/p-2 |
| InChIKey | NNMNCZOEIIUPDO-UHFFFAOYSA-L |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.01 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|