C20H37N3O4 — CID 159831774
(3E,5S,8R,10R)-10-hydroxy-8-[(3S,4R)-4-hydroxy-2-oxo-3-(propan-2-ylamino)pentyl]-2,5-dimethyl-1,6-diazacyclododec-3-en-7-one (PubChem CID 159831774) has the molecular formula C20H37N3O4 and a molecular weight of 383.53 g/mol. Its IUPAC name is (3E,5S,8R,10R)-10-hydroxy-8-[(3S,4R)-4-hydroxy-2-oxo-3-(propan-2-ylamino)pentyl]-2,5-dimethyl-1,6-diazacyclododec-3-en-7-one.
| Compound Name | (3E,5S,8R,10R)-10-hydroxy-8-[(3S,4R)-4-hydroxy-2-oxo-3-(propan-2-ylamino)pentyl]-2,5-dimethyl-1,6-diazacyclododec-3-en-7-one |
|---|---|
| PubChem CID | 159831774 |
| Molecular Formula | C20H37N3O4 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (3E,5S,8R,10R)-10-hydroxy-8-[(3S,4R)-4-hydroxy-2-oxo-3-(propan-2-ylamino)pentyl]-2,5-dimethyl-1,6-diazacyclododec-3-en-7-one |
| SMILES | CC(C)N[C@H](C(=O)C[C@H]1C[C@@H](O)CCNC(C)/C=C/[C@H](C)NC1=O)[C@@H](C)O |
| InChI | InChI=1S/C20H37N3O4/c1-12(2)22-19(15(5)24)18(26)11-16-10-17(25)8-9-21-13(3)6-7-14(4)23-20(16)27/h6-7,12-17,19,21-22,24-25H,8-11H2,1-5H3,(H,23,27)/b7-6+/t13?,14-,15+,16+,17-,19-/m0/s1 |
| InChIKey | VSIMVUDSEGAOPV-GADSTSKZSA-N |
| XLogP | 0.50 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|