C19H30O4S — CID 159833848
2-dispiro[2.0.24.13]heptan-7-ylethanol;2-dispiro[2.0.24.13]heptan-7-ylethyl methanesulfonate (PubChem CID 159833848) has the molecular formula C19H30O4S and a molecular weight of 354.51 g/mol. Its IUPAC name is 2-dispiro[2.0.24.13]heptan-7-ylethanol;2-dispiro[2.0.24.13]heptan-7-ylethyl methanesulfonate.
| Compound Name | 2-dispiro[2.0.24.13]heptan-7-ylethanol;2-dispiro[2.0.24.13]heptan-7-ylethyl methanesulfonate |
|---|---|
| PubChem CID | 159833848 |
| Molecular Formula | C19H30O4S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-dispiro[2.0.24.13]heptan-7-ylethanol;2-dispiro[2.0.24.13]heptan-7-ylethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC1C2(CC2)C12CC2.OCCC1C2(CC2)C12CC2 |
| InChI | InChI=1S/C10H16O3S.C9H14O/c1-14(11,12)13-7-2-8-9(3-4-9)10(8)5-6-10;10-6-1-7-8(2-3-8)9(7)4-5-9/h8H,2-7H2,1H3;7,10H,1-6H2 |
| InChIKey | NNUMSUFYEJWWAE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|