C36H38 — CID 159834220
4-(cyclopenta-2,4-dien-1-ylmethyl)-1H-indene;2-[(1-methyl-1H-inden-4-yl)methyl]-2,4,5,6,7,8-hexahydroazulene (PubChem CID 159834220) has the molecular formula C36H38 and a molecular weight of 470.70 g/mol. Its IUPAC name is 4-(cyclopenta-2,4-dien-1-ylmethyl)-1H-indene;2-[(1-methyl-1H-inden-4-yl)methyl]-2,4,5,6,7,8-hexahydroazulene.
| Compound Name | 4-(cyclopenta-2,4-dien-1-ylmethyl)-1H-indene;2-[(1-methyl-1H-inden-4-yl)methyl]-2,4,5,6,7,8-hexahydroazulene |
|---|---|
| PubChem CID | 159834220 |
| Molecular Formula | C36H38 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 4-(cyclopenta-2,4-dien-1-ylmethyl)-1H-indene;2-[(1-methyl-1H-inden-4-yl)methyl]-2,4,5,6,7,8-hexahydroazulene |
| SMILES | C1=CC(Cc2cccc3c2C=CC3)C=C1.CC1C=Cc2c(CC3C=C4CCCCCC4=C3)cccc21 |
| InChI | InChI=1S/C21H24.C15H14/c1-15-10-11-21-19(8-5-9-20(15)21)14-16-12-17-6-3-2-4-7-18(17)13-16;1-2-6-12(5-1)11-14-9-3-7-13-8-4-10-15(13)14/h5,8-13,15-16H,2-4,6-7,14H2,1H3;1-7,9-10,12H,8,11H2 |
| InChIKey | NNVUOPUAAZPBAG-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |