About lithium;methanidylbenzene;pentane
lithium;methanidylbenzene;pentane (PubChem CID 159836636) has the molecular formula C12H19Li
and a molecular weight of 170.22 g/mol. Its IUPAC name is lithium;methanidylbenzene;pentane.
Molecular Properties
| Compound Name | lithium;methanidylbenzene;pentane |
| PubChem CID | 159836636 |
| Molecular Formula | C12H19Li |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.16 |
| IUPAC Name | lithium;methanidylbenzene;pentane |
| SMILES | CCCCC.[CH2-]c1ccccc1.[Li+] |
| InChI | InChI=1S/C7H7.C5H12.Li/c1-7-5-3-2-4-6-7;1-3-5-4-2;/h2-6H,1H2;3-5H2,1-2H3;/q-1;;+1 |
| InChIKey | ZOSMKVGITVBCQH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;methanidylbenzene;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;methanidylbenzene;pentane?
The IUPAC name of lithium;methanidylbenzene;pentane (CID 159836636) is lithium;methanidylbenzene;pentane.
What is the SMILES notation for lithium;methanidylbenzene;pentane?
The canonical SMILES for lithium;methanidylbenzene;pentane is CCCCC.[CH2-]c1ccccc1.[Li+].
What is the InChIKey of lithium;methanidylbenzene;pentane?
The InChIKey is ZOSMKVGITVBCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C5H12.Li/c1-7-5-3-2-4-6-7;1-3-5-4-2;/h2-6H,1H2;3-5H2,1-2H3;/q-1;;+1.
What are the key properties of lithium;methanidylbenzene;pentane?
lithium;methanidylbenzene;pentane has a molecular weight of 170.22 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;methanidylbenzene;pentane is sourced from PubChem (CID 159836636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).