lithium;methanidylbenzene;2-pentoxyacetic acid

C14H21LiO3 — CID 158678473

IUPAClithium;methanidylbenzene;2-pentoxyacetic acid
SMILESCCCCCOCC(=O)O.[CH2-]c1ccccc1.[Li+]
InChIInChI=1S/C7H14O3.C7H7.Li/c1-2-3-4-5-10-6-7(8)9;1-7-5-3-2-4-6-7;/h2-6H2,1H3,(H,8,9);2-6H,1H2;/q;-1;+1
InChIKeyCEYSLXDEXPJMJT-UHFFFAOYSA-N
MW244.26 g/mol
LogP0.15
Rot. Bonds6

About lithium;methanidylbenzene;2-pentoxyacetic acid

lithium;methanidylbenzene;2-pentoxyacetic acid (PubChem CID 158678473) has the molecular formula C14H21LiO3 and a molecular weight of 244.26 g/mol. Its IUPAC name is lithium;methanidylbenzene;2-pentoxyacetic acid.

Molecular Properties

Compound Namelithium;methanidylbenzene;2-pentoxyacetic acid
PubChem CID158678473
Molecular FormulaC14H21LiO3
Molecular Weight244.26 g/mol
Exact Mass244.17
IUPAC Namelithium;methanidylbenzene;2-pentoxyacetic acid
SMILESCCCCCOCC(=O)O.[CH2-]c1ccccc1.[Li+]
InChIInChI=1S/C7H14O3.C7H7.Li/c1-2-3-4-5-10-6-7(8)9;1-7-5-3-2-4-6-7;/h2-6H2,1H3,(H,8,9);2-6H,1H2;/q;-1;+1
InChIKeyCEYSLXDEXPJMJT-UHFFFAOYSA-N
XLogP0.15
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.26
LogP ≤ 50.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze lithium;methanidylbenzene;2-pentoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of lithium;methanidylbenzene;2-pentoxyacetic acid?
The IUPAC name of lithium;methanidylbenzene;2-pentoxyacetic acid (CID 158678473) is lithium;methanidylbenzene;2-pentoxyacetic acid.
What is the SMILES notation for lithium;methanidylbenzene;2-pentoxyacetic acid?
The canonical SMILES for lithium;methanidylbenzene;2-pentoxyacetic acid is CCCCCOCC(=O)O.[CH2-]c1ccccc1.[Li+].
What is the InChIKey of lithium;methanidylbenzene;2-pentoxyacetic acid?
The InChIKey is CEYSLXDEXPJMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3.C7H7.Li/c1-2-3-4-5-10-6-7(8)9;1-7-5-3-2-4-6-7;/h2-6H2,1H3,(H,8,9);2-6H,1H2;/q;-1;+1.
What are the key properties of lithium;methanidylbenzene;2-pentoxyacetic acid?
lithium;methanidylbenzene;2-pentoxyacetic acid has a molecular weight of 244.26 g/mol, XLogP of 0.15, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;methanidylbenzene;2-pentoxyacetic acid is sourced from PubChem (CID 158678473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).