C14H21LiO3 — CID 158678473
lithium;methanidylbenzene;2-pentoxyacetic acid (PubChem CID 158678473) has the molecular formula C14H21LiO3 and a molecular weight of 244.26 g/mol. Its IUPAC name is lithium;methanidylbenzene;2-pentoxyacetic acid.
| Compound Name | lithium;methanidylbenzene;2-pentoxyacetic acid |
|---|---|
| PubChem CID | 158678473 |
| Molecular Formula | C14H21LiO3 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | lithium;methanidylbenzene;2-pentoxyacetic acid |
| SMILES | CCCCCOCC(=O)O.[CH2-]c1ccccc1.[Li+] |
| InChI | InChI=1S/C7H14O3.C7H7.Li/c1-2-3-4-5-10-6-7(8)9;1-7-5-3-2-4-6-7;/h2-6H2,1H3,(H,8,9);2-6H,1H2;/q;-1;+1 |
| InChIKey | CEYSLXDEXPJMJT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|