About N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride
N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride (PubChem CID 159854214) has the molecular formula C24H34ClNO
and a molecular weight of 388.00 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride |
| PubChem CID | 159854214 |
| Molecular Formula | C24H34ClNO |
| Molecular Weight | 388.00 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride |
| SMILES | CON(CC1CC1)CC(Cc1c(C)cccc1C)c1c(C)cccc1C.Cl |
| InChI | InChI=1S/C24H33NO.ClH/c1-17-8-6-9-18(2)23(17)14-22(16-25(26-5)15-21-12-13-21)24-19(3)10-7-11-20(24)4;/h6-11,21-22H,12-16H2,1-5H3;1H |
| InChIKey | NQHXWWWQOXVSJQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.00 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride?
The IUPAC name of N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride (CID 159854214) is N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride.
What is the SMILES notation for N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride?
The canonical SMILES for N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride is CON(CC1CC1)CC(Cc1c(C)cccc1C)c1c(C)cccc1C.Cl.
What is the InChIKey of N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride?
The InChIKey is NQHXWWWQOXVSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NO.ClH/c1-17-8-6-9-18(2)23(17)14-22(16-25(26-5)15-21-12-13-21)24-19(3)10-7-11-20(24)4;/h6-11,21-22H,12-16H2,1-5H3;1H.
What are the key properties of N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride?
N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride has a molecular weight of 388.00 g/mol, XLogP of 5.94, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-2,3-bis(2,6-dimethylphenyl)-N-methoxypropan-1-amine;hydrochloride is sourced from PubChem (CID 159854214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).