C22H29BrFNO — CID 160605058
N-(cyclopropylmethyl)-2-(2,6-dimethylphenyl)-3-(2-fluorophenyl)-N-methoxypropan-1-amine;hydrobromide (PubChem CID 160605058) has the molecular formula C22H29BrFNO and a molecular weight of 422.38 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2,6-dimethylphenyl)-3-(2-fluorophenyl)-N-methoxypropan-1-amine;hydrobromide.
| Compound Name | N-(cyclopropylmethyl)-2-(2,6-dimethylphenyl)-3-(2-fluorophenyl)-N-methoxypropan-1-amine;hydrobromide |
|---|---|
| PubChem CID | 160605058 |
| Molecular Formula | C22H29BrFNO |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2,6-dimethylphenyl)-3-(2-fluorophenyl)-N-methoxypropan-1-amine;hydrobromide |
| SMILES | Br.CON(CC1CC1)CC(Cc1ccccc1F)c1c(C)cccc1C |
| InChI | InChI=1S/C22H28FNO.BrH/c1-16-7-6-8-17(2)22(16)20(13-19-9-4-5-10-21(19)23)15-24(25-3)14-18-11-12-18;/h4-10,18,20H,11-15H2,1-3H3;1H |
| InChIKey | RETNZECWIIDIPQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|