C32H26F4N2O3S — CID 159855975
6-(3,5-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione;6-(3,5-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazin-2-one (PubChem CID 159855975) has the molecular formula C32H26F4N2O3S and a molecular weight of 594.63 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione;6-(3,5-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazin-2-one.
| Compound Name | 6-(3,5-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione;6-(3,5-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 159855975 |
| Molecular Formula | C32H26F4N2O3S |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 6-(3,5-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione;6-(3,5-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| SMILES | CC1(C)OC(=O)Nc2ccc(-c3cc(F)cc(F)c3)cc21.CC1(C)OC(=S)Nc2ccc(-c3cc(F)cc(F)c3)cc21 |
| InChI | InChI=1S/C16H13F2NO2.C16H13F2NOS/c1-16(2)13-7-9(3-4-14(13)19-15(20)21-16)10-5-11(17)8-12(18)6-10;1-16(2)13-7-9(3-4-14(13)19-15(21)20-16)10-5-11(17)8-12(18)6-10/h3-8H,1-2H3,(H,19,20);3-8H,1-2H3,(H,19,21) |
| InChIKey | NQNMSALPOJRSGH-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|