C19H22IO6S- — CID 159857736
1,3-benzodioxol-5-ylmethyl sulfate;1-iodo-4-(2-methylbutan-2-yl)benzene (PubChem CID 159857736) has the molecular formula C19H22IO6S- and a molecular weight of 505.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl sulfate;1-iodo-4-(2-methylbutan-2-yl)benzene.
| Compound Name | 1,3-benzodioxol-5-ylmethyl sulfate;1-iodo-4-(2-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 159857736 |
| Molecular Formula | C19H22IO6S- |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl sulfate;1-iodo-4-(2-methylbutan-2-yl)benzene |
| SMILES | CCC(C)(C)c1ccc(I)cc1.O=S(=O)([O-])OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15I.C8H8O6S/c1-4-11(2,3)9-5-7-10(12)8-6-9;9-15(10,11)14-4-6-1-2-7-8(3-6)13-5-12-7/h5-8H,4H2,1-3H3;1-3H,4-5H2,(H,9,10,11)/p-1 |
| InChIKey | NQSYIWHBXAORNG-UHFFFAOYSA-M |
| XLogP | 4.37 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|