About 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline
2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline (PubChem CID 159859680) has the molecular formula C14H15F2IN2
and a molecular weight of 376.19 g/mol. Its IUPAC name is 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline.
Molecular Properties
| Compound Name | 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline |
| PubChem CID | 159859680 |
| Molecular Formula | C14H15F2IN2 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline |
| SMILES | Cc1cc(F)c(N)c(I)c1.Cc1ccc(N)c(F)c1 |
| InChI | InChI=1S/C7H7FIN.C7H8FN/c1-4-2-5(8)7(10)6(9)3-4;1-5-2-3-7(9)6(8)4-5/h2-3H,10H2,1H3;2-4H,9H2,1H3 |
| InChIKey | NQZCZQDALYSLJR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline?
The IUPAC name of 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline (CID 159859680) is 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline.
What is the SMILES notation for 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline?
The canonical SMILES for 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline is Cc1cc(F)c(N)c(I)c1.Cc1ccc(N)c(F)c1.
What is the InChIKey of 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline?
The InChIKey is NQZCZQDALYSLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FIN.C7H8FN/c1-4-2-5(8)7(10)6(9)3-4;1-5-2-3-7(9)6(8)4-5/h2-3H,10H2,1H3;2-4H,9H2,1H3.
What are the key properties of 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline?
2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline has a molecular weight of 376.19 g/mol, XLogP of 4.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-iodo-4-methylaniline;2-fluoro-4-methylaniline is sourced from PubChem (CID 159859680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).