C20H14ClF2N3 — CID 159862721
5-[2-(2-chloro-4,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]-1H-isoindole (PubChem CID 159862721) has the molecular formula C20H14ClF2N3 and a molecular weight of 369.80 g/mol. Its IUPAC name is 5-[2-(2-chloro-4,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]-1H-isoindole.
| Compound Name | 5-[2-(2-chloro-4,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]-1H-isoindole |
|---|---|
| PubChem CID | 159862721 |
| Molecular Formula | C20H14ClF2N3 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 5-[2-(2-chloro-4,5-difluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]-1H-isoindole |
| SMILES | Fc1cc(Cl)c(-c2nc3n(c2-c2ccc4c(c2)C=NC4)CCC3)cc1F |
| InChI | InChI=1S/C20H14ClF2N3/c21-15-8-17(23)16(22)7-14(15)19-20(26-5-1-2-18(26)25-19)11-3-4-12-9-24-10-13(12)6-11/h3-4,6-8,10H,1-2,5,9H2 |
| InChIKey | NRIUGVMNLWGUEL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|