C47H34BBr2O2+ — CID 159866283
1,8-bis(1H-inden-2-yl)naphthalene;1,8-dibromonaphthalene;1,6-dihydroinden-6-ylium-2-ylboronic acid (PubChem CID 159866283) has the molecular formula C47H34BBr2O2+ and a molecular weight of 801.41 g/mol. Its IUPAC name is 1,8-bis(1H-inden-2-yl)naphthalene;1,8-dibromonaphthalene;1,6-dihydroinden-6-ylium-2-ylboronic acid.
| Compound Name | 1,8-bis(1H-inden-2-yl)naphthalene;1,8-dibromonaphthalene;1,6-dihydroinden-6-ylium-2-ylboronic acid |
|---|---|
| PubChem CID | 159866283 |
| Molecular Formula | C47H34BBr2O2+ |
| Molecular Weight | 801.41 g/mol |
| Exact Mass | 799.10 |
| IUPAC Name | 1,8-bis(1H-inden-2-yl)naphthalene;1,8-dibromonaphthalene;1,6-dihydroinden-6-ylium-2-ylboronic acid |
| SMILES | Brc1cccc2cccc(Br)c12.C1=C(c2cccc3cccc(C4=Cc5ccccc5C4)c23)Cc2ccccc21.OB(O)C1=CC2=C(C=[C+]C=C2)C1 |
| InChI | InChI=1S/C28H20.C10H6Br2.C9H8BO2/c1-2-8-21-16-24(15-20(21)7-1)26-13-5-11-19-12-6-14-27(28(19)26)25-17-22-9-3-4-10-23(22)18-25;11-8-5-1-3-7-4-2-6-9(12)10(7)8;11-10(12)9-5-7-3-1-2-4-8(7)6-9/h1-15,17H,16,18H2;1-6H;1,3-5,11-12H,6H2/q;;+1 |
| InChIKey | NRTPVFCWHQRPGT-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.41 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|