C24H31FN6O3S — CID 159869563
2-fluoro-5-[4-[[4-(4-methylsulfinylpiperazin-1-yl)cyclohexyl]amino]quinazolin-6-yl]pyridin-3-ol;hydrate (PubChem CID 159869563) has the molecular formula C24H31FN6O3S and a molecular weight of 502.62 g/mol. Its IUPAC name is 2-fluoro-5-[4-[[4-(4-methylsulfinylpiperazin-1-yl)cyclohexyl]amino]quinazolin-6-yl]pyridin-3-ol;hydrate.
| Compound Name | 2-fluoro-5-[4-[[4-(4-methylsulfinylpiperazin-1-yl)cyclohexyl]amino]quinazolin-6-yl]pyridin-3-ol;hydrate |
|---|---|
| PubChem CID | 159869563 |
| Molecular Formula | C24H31FN6O3S |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-fluoro-5-[4-[[4-(4-methylsulfinylpiperazin-1-yl)cyclohexyl]amino]quinazolin-6-yl]pyridin-3-ol;hydrate |
| SMILES | CS(=O)N1CCN(C2CCC(Nc3ncnc4ccc(-c5cnc(F)c(O)c5)cc34)CC2)CC1.O |
| InChI | InChI=1S/C24H29FN6O2S.H2O/c1-34(33)31-10-8-30(9-11-31)19-5-3-18(4-6-19)29-24-20-12-16(2-7-21(20)27-15-28-24)17-13-22(32)23(25)26-14-17;/h2,7,12-15,18-19,32H,3-6,8-11H2,1H3,(H,27,28,29);1H2 |
| InChIKey | NSPXYLQWKYRWKQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|