C22H31NO5 — CID 15987153
bis(2,2-dimethylpropyl) 2-[(4-acetamidophenyl)methylidene]propanedioate (PubChem CID 15987153) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2-[(4-acetamidophenyl)methylidene]propanedioate.
| Compound Name | bis(2,2-dimethylpropyl) 2-[(4-acetamidophenyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 15987153 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2-[(4-acetamidophenyl)methylidene]propanedioate |
| SMILES | CC(=O)Nc1ccc(C=C(C(=O)OCC(C)(C)C)C(=O)OCC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31NO5/c1-15(24)23-17-10-8-16(9-11-17)12-18(19(25)27-13-21(2,3)4)20(26)28-14-22(5,6)7/h8-12H,13-14H2,1-7H3,(H,23,24) |
| InChIKey | NRDRVIWMNAMFIS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|