C20H28O3S — CID 88945095
2,2-dimethylpropyl (Z)-2-(2,2-dimethylpropylsulfanylcarbonyl)-3-phenylprop-2-enoate (PubChem CID 88945095) has the molecular formula C20H28O3S and a molecular weight of 348.51 g/mol. Its IUPAC name is 2,2-dimethylpropyl (Z)-2-(2,2-dimethylpropylsulfanylcarbonyl)-3-phenylprop-2-enoate.
| Compound Name | 2,2-dimethylpropyl (Z)-2-(2,2-dimethylpropylsulfanylcarbonyl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 88945095 |
| Molecular Formula | C20H28O3S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2,2-dimethylpropyl (Z)-2-(2,2-dimethylpropylsulfanylcarbonyl)-3-phenylprop-2-enoate |
| SMILES | CC(C)(C)COC(=O)/C(=C/c1ccccc1)C(=O)SCC(C)(C)C |
| InChI | InChI=1S/C20H28O3S/c1-19(2,3)13-23-17(21)16(12-15-10-8-7-9-11-15)18(22)24-14-20(4,5)6/h7-12H,13-14H2,1-6H3/b16-12- |
| InChIKey | JFTRFRAQQIUYSF-VBKFSLOCSA-N |
| XLogP | 4.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|