C40H38BBrN4O6S2 — CID 159878554
1-(benzenesulfonyl)-3-bromo-5-isocyano-2,6-dimethylindole;1-(benzenesulfonyl)-5-isocyano-2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 159878554) has the molecular formula C40H38BBrN4O6S2 and a molecular weight of 825.62 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-bromo-5-isocyano-2,6-dimethylindole;1-(benzenesulfonyl)-5-isocyano-2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-(benzenesulfonyl)-3-bromo-5-isocyano-2,6-dimethylindole;1-(benzenesulfonyl)-5-isocyano-2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 159878554 |
| Molecular Formula | C40H38BBrN4O6S2 |
| Molecular Weight | 825.62 g/mol |
| Exact Mass | 824.15 |
| IUPAC Name | 1-(benzenesulfonyl)-3-bromo-5-isocyano-2,6-dimethylindole;1-(benzenesulfonyl)-5-isocyano-2,6-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | [C-]#[N+]c1cc2c(B3OC(C)(C)C(C)(C)O3)c(C)n(S(=O)(=O)c3ccccc3)c2cc1C.[C-]#[N+]c1cc2c(Br)c(C)n(S(=O)(=O)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C23H25BN2O4S.C17H13BrN2O2S/c1-15-13-20-18(14-19(15)25-7)21(24-29-22(3,4)23(5,6)30-24)16(2)26(20)31(27,28)17-11-9-8-10-12-17;1-11-9-16-14(10-15(11)19-3)17(18)12(2)20(16)23(21,22)13-7-5-4-6-8-13/h8-14H,1-6H3;4-10H,1-2H3 |
| InChIKey | NTFQHSOKBKSUPG-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 105.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.62 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|