C42H31N5O4S2 — CID 159891205
acetic acid;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carbonitrile;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide (PubChem CID 159891205) has the molecular formula C42H31N5O4S2 and a molecular weight of 733.88 g/mol. Its IUPAC name is acetic acid;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carbonitrile;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide.
| Compound Name | acetic acid;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carbonitrile;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 159891205 |
| Molecular Formula | C42H31N5O4S2 |
| Molecular Weight | 733.88 g/mol |
| Exact Mass | 733.18 |
| IUPAC Name | acetic acid;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carbonitrile;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide |
| SMILES | CC(=O)O.N#Cc1cc2c(Oc3ccc(-c4ccccc4)cc3)cncc2s1.[H]/N=C(\N)c1cc2c(Oc3ccc(-c4ccccc4)cc3)cncc2s1 |
| InChI | InChI=1S/C20H15N3OS.C20H12N2OS.C2H4O2/c21-20(22)18-10-16-17(11-23-12-19(16)25-18)24-15-8-6-14(7-9-15)13-4-2-1-3-5-13;21-11-17-10-18-19(12-22-13-20(18)24-17)23-16-8-6-15(7-9-16)14-4-2-1-3-5-14;1-2(3)4/h1-12H,(H3,21,22);1-10,12-13H;1H3,(H,3,4) |
| InChIKey | AFSFFSWEUSBYRK-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 155.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.88 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|